C13H16Cl2N2O — CID 64683722
2-(1-aminocyclopentyl)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 64683722) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 2-(1-aminocyclopentyl)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(1-aminocyclopentyl)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 64683722 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(1-aminocyclopentyl)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | NC1(CC(=O)Nc2cc(Cl)ccc2Cl)CCCC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-9-3-4-10(15)11(7-9)17-12(18)8-13(16)5-1-2-6-13/h3-4,7H,1-2,5-6,8,16H2,(H,17,18) |
| InChIKey | ZWMLHKFBPQTGAJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |