C14H18FIN2O — CID 79766274
2-(1-aminocyclohexyl)-N-(4-fluoro-2-iodophenyl)acetamide (PubChem CID 79766274) has the molecular formula C14H18FIN2O and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-(1-aminocyclohexyl)-N-(4-fluoro-2-iodophenyl)acetamide.
| Compound Name | 2-(1-aminocyclohexyl)-N-(4-fluoro-2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 79766274 |
| Molecular Formula | C14H18FIN2O |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(1-aminocyclohexyl)-N-(4-fluoro-2-iodophenyl)acetamide |
| SMILES | NC1(CC(=O)Nc2ccc(F)cc2I)CCCCC1 |
| InChI | InChI=1S/C14H18FIN2O/c15-10-4-5-12(11(16)8-10)18-13(19)9-14(17)6-2-1-3-7-14/h4-5,8H,1-3,6-7,9,17H2,(H,18,19) |
| InChIKey | KYNLWFWZXJXHPG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|