C16H24ClN2O+ — CID 8583722
2-(azocan-1-ium-1-yl)-N-(2-chloro-4-methylphenyl)acetamide (PubChem CID 8583722) has the molecular formula C16H24ClN2O+ and a molecular weight of 295.83 g/mol. Its IUPAC name is 2-(azocan-1-ium-1-yl)-N-(2-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-(azocan-1-ium-1-yl)-N-(2-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8583722 |
| Molecular Formula | C16H24ClN2O+ |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(azocan-1-ium-1-yl)-N-(2-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[NH+]2CCCCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClN2O/c1-13-7-8-15(14(17)11-13)18-16(20)12-19-9-5-3-2-4-6-10-19/h7-8,11H,2-6,9-10,12H2,1H3,(H,18,20)/p+1 |
| InChIKey | WUFZGKKLHRKPLP-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |