C13H17F2N2O+ — CID 6934505
N-(2,4-difluorophenyl)-2-piperidin-1-ium-1-ylacetamide (PubChem CID 6934505) has the molecular formula C13H17F2N2O+ and a molecular weight of 255.29 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 6934505 |
| Molecular Formula | C13H17F2N2O+ |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-piperidin-1-ium-1-ylacetamide |
| SMILES | O=C(C[NH+]1CCCCC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H16F2N2O/c14-10-4-5-12(11(15)8-10)16-13(18)9-17-6-2-1-3-7-17/h4-5,8H,1-3,6-7,9H2,(H,16,18)/p+1 |
| InChIKey | OHILBOUXYWRSJC-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |