C19H22F2N3O+ — CID 2208104
1-(2,4-difluorophenyl)-3-[4-(piperidin-1-ium-1-ylmethyl)phenyl]urea (PubChem CID 2208104) has the molecular formula C19H22F2N3O+ and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-(piperidin-1-ium-1-ylmethyl)phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-(piperidin-1-ium-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 2208104 |
| Molecular Formula | C19H22F2N3O+ |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-(piperidin-1-ium-1-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C[NH+]2CCCCC2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H21F2N3O/c20-15-6-9-18(17(21)12-15)23-19(25)22-16-7-4-14(5-8-16)13-24-10-2-1-3-11-24/h4-9,12H,1-3,10-11,13H2,(H2,22,23,25)/p+1 |
| InChIKey | XYZGMZMTFCLQDP-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 45.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |