C13H11F2N3O4S — CID 70694601
[4-[(2,4-difluorophenyl)carbamoylamino]phenyl] sulfamate (PubChem CID 70694601) has the molecular formula C13H11F2N3O4S and a molecular weight of 343.31 g/mol. Its IUPAC name is [4-[(2,4-difluorophenyl)carbamoylamino]phenyl] sulfamate.
| Compound Name | [4-[(2,4-difluorophenyl)carbamoylamino]phenyl] sulfamate |
|---|---|
| PubChem CID | 70694601 |
| Molecular Formula | C13H11F2N3O4S |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [4-[(2,4-difluorophenyl)carbamoylamino]phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(NC(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C13H11F2N3O4S/c14-8-1-6-12(11(15)7-8)18-13(19)17-9-2-4-10(5-3-9)22-23(16,20)21/h1-7H,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | XHTGRFBIHWSAHX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |