C13H8BrF3N2O — CID 107612564
1-(4-bromo-2,5-difluorophenyl)-3-(4-fluorophenyl)urea (PubChem CID 107612564) has the molecular formula C13H8BrF3N2O and a molecular weight of 345.12 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 107612564 |
| Molecular Formula | C13H8BrF3N2O |
| Molecular Weight | 345.12 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C13H8BrF3N2O/c14-9-5-11(17)12(6-10(9)16)19-13(20)18-8-3-1-7(15)2-4-8/h1-6H,(H2,18,19,20) |
| InChIKey | JSWBBSMQTYWWGX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.12 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|