C14H19F2N2O+ — CID 2681830
N-(2,4-difluorophenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 2681830) has the molecular formula C14H19F2N2O+ and a molecular weight of 269.31 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2681830 |
| Molecular Formula | C14H19F2N2O+ |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | C[C@H]1CCC[NH+](CC(=O)Nc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H18F2N2O/c1-10-3-2-6-18(8-10)9-14(19)17-13-5-4-11(15)7-12(13)16/h4-5,7,10H,2-3,6,8-9H2,1H3,(H,17,19)/p+1/t10-/m0/s1 |
| InChIKey | IIFLZZMBZSASCL-JTQLQIEISA-O |
| XLogP | 1.22 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |