C18H30N3O4S+ — CID 7392316
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 7392316) has the molecular formula C18H30N3O4S+ and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7392316 |
| Molecular Formula | C18H30N3O4S+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)C[NH+]2CCC[C@H](C)C2)c1 |
| InChI | InChI=1S/C18H29N3O4S/c1-4-21(5-2)26(24,25)15-8-9-17(22)16(11-15)19-18(23)13-20-10-6-7-14(3)12-20/h8-9,11,14,22H,4-7,10,12-13H2,1-3H3,(H,19,23)/p+1/t14-/m0/s1 |
| InChIKey | ATAQZSMIADPWRT-AWEZNQCLSA-O |
| XLogP | 0.68 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|