C21H27N3O5S — CID 35995593
N-[2-[5-(diethylsulfamoyl)-2-hydroxyanilino]-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 35995593) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[2-[5-(diethylsulfamoyl)-2-hydroxyanilino]-2-oxoethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-[5-(diethylsulfamoyl)-2-hydroxyanilino]-2-oxoethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 35995593 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[2-[5-(diethylsulfamoyl)-2-hydroxyanilino]-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)CNC(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-5-24(6-2)30(28,29)17-7-8-19(25)18(12-17)23-20(26)13-22-21(27)16-10-14(3)9-15(4)11-16/h7-12,25H,5-6,13H2,1-4H3,(H,22,27)(H,23,26) |
| InChIKey | NDGXVQKOHSBIBM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|