C18H21FN2O5S — CID 3615295
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-fluorophenoxy)acetamide (PubChem CID 3615295) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 3615295 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-fluorophenoxy)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)COc2ccccc2F)c1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-3-21(4-2)27(24,25)13-9-10-16(22)15(11-13)20-18(23)12-26-17-8-6-5-7-14(17)19/h5-11,22H,3-4,12H2,1-2H3,(H,20,23) |
| InChIKey | PNDRIPMUPHRRPV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|