C20H26N2O6S — CID 55702289
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-phenoxyethoxy)acetamide (PubChem CID 55702289) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-phenoxyethoxy)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-phenoxyethoxy)acetamide |
|---|---|
| PubChem CID | 55702289 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-(2-phenoxyethoxy)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)COCCOc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N2O6S/c1-3-22(4-2)29(25,26)17-10-11-19(23)18(14-17)21-20(24)15-27-12-13-28-16-8-6-5-7-9-16/h5-11,14,23H,3-4,12-13,15H2,1-2H3,(H,21,24) |
| InChIKey | OIMGYPOBAQWEQU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|