C16H16FNO4S — CID 51198508
2-(2-fluorophenoxy)-N-(2-methyl-5-methylsulfonylphenyl)acetamide (PubChem CID 51198508) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(2-methyl-5-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(2-methyl-5-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 51198508 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(2-methyl-5-methylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NC(=O)COc1ccccc1F |
| InChI | InChI=1S/C16H16FNO4S/c1-11-7-8-12(23(2,20)21)9-14(11)18-16(19)10-22-15-6-4-3-5-13(15)17/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | RGXLJZUQPQWVPM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |