C17H16F3NO4S — CID 46686699
N-(2-methyl-5-methylsulfonylphenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide (PubChem CID 46686699) has the molecular formula C17H16F3NO4S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-(2-methyl-5-methylsulfonylphenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(2-methyl-5-methylsulfonylphenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 46686699 |
| Molecular Formula | C17H16F3NO4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-(2-methyl-5-methylsulfonylphenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NC(=O)COc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO4S/c1-11-7-8-12(26(2,23)24)9-14(11)21-16(22)10-25-15-6-4-3-5-13(15)17(18,19)20/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | UEFSVTQSGYJTRH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |