C15H10F5NO2 — CID 39088986
N-(2,5-difluorophenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide (PubChem CID 39088986) has the molecular formula C15H10F5NO2 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 39088986 |
| Molecular Formula | C15H10F5NO2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[2-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1C(F)(F)F)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H10F5NO2/c16-9-5-6-11(17)12(7-9)21-14(22)8-23-13-4-2-1-3-10(13)15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | MOXRAOCOXUIMPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |