C14H9ClF3NO2 — CID 30273064
2-(2-chloro-4-fluorophenoxy)-N-(2,5-difluorophenyl)acetamide (PubChem CID 30273064) has the molecular formula C14H9ClF3NO2 and a molecular weight of 315.68 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 30273064 |
| Molecular Formula | C14H9ClF3NO2 |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-(2,5-difluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(F)cc1Cl)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H9ClF3NO2/c15-10-5-8(16)2-4-13(10)21-7-14(20)19-12-6-9(17)1-3-11(12)18/h1-6H,7H2,(H,19,20) |
| InChIKey | WMYRDOPOLSXQJZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |