C18H18FNO4S — CID 9246477
2-(2-fluorophenoxy)-N-(2-methyl-5-prop-2-enylsulfonylphenyl)acetamide (PubChem CID 9246477) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(2-methyl-5-prop-2-enylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(2-methyl-5-prop-2-enylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 9246477 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(2-methyl-5-prop-2-enylsulfonylphenyl)acetamide |
| SMILES | C=CCS(=O)(=O)c1ccc(C)c(NC(=O)COc2ccccc2F)c1 |
| InChI | InChI=1S/C18H18FNO4S/c1-3-10-25(22,23)14-9-8-13(2)16(11-14)20-18(21)12-24-17-7-5-4-6-15(17)19/h3-9,11H,1,10,12H2,2H3,(H,20,21) |
| InChIKey | OLDYPYLIDXZGQS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|