C17H15F2NO3S — CID 9246462
2,4-difluoro-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzamide (PubChem CID 9246462) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzamide.
| Compound Name | 2,4-difluoro-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 9246462 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2,4-difluoro-N-(2-methyl-5-prop-2-enylsulfonylphenyl)benzamide |
| SMILES | C=CCS(=O)(=O)c1ccc(C)c(NC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H15F2NO3S/c1-3-8-24(22,23)13-6-4-11(2)16(10-13)20-17(21)14-7-5-12(18)9-15(14)19/h3-7,9-10H,1,8H2,2H3,(H,20,21) |
| InChIKey | MKQSHDWXBLWSOP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|