C18H18ClFN2O3S — CID 35823056
N-(3-chloro-4-fluorophenyl)-2-(2-methyl-5-prop-2-enylsulfonylanilino)acetamide (PubChem CID 35823056) has the molecular formula C18H18ClFN2O3S and a molecular weight of 396.87 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(2-methyl-5-prop-2-enylsulfonylanilino)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(2-methyl-5-prop-2-enylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 35823056 |
| Molecular Formula | C18H18ClFN2O3S |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(2-methyl-5-prop-2-enylsulfonylanilino)acetamide |
| SMILES | C=CCS(=O)(=O)c1ccc(C)c(NCC(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H18ClFN2O3S/c1-3-8-26(24,25)14-6-4-12(2)17(10-14)21-11-18(23)22-13-5-7-16(20)15(19)9-13/h3-7,9-10,21H,1,8,11H2,2H3,(H,22,23) |
| InChIKey | GERANZXIJWJMEW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|