C22H19ClFN3O2 — CID 52703647
3-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4-methyl-N-phenylbenzamide (PubChem CID 52703647) has the molecular formula C22H19ClFN3O2 and a molecular weight of 411.86 g/mol. Its IUPAC name is 3-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4-methyl-N-phenylbenzamide.
| Compound Name | 3-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 52703647 |
| Molecular Formula | C22H19ClFN3O2 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 3-[[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]amino]-4-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1NCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H19ClFN3O2/c1-14-7-8-15(22(29)27-16-5-3-2-4-6-16)11-20(14)25-13-21(28)26-17-9-10-19(24)18(23)12-17/h2-12,25H,13H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | VRTCLVMXSHQLTD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |