C11H11ClFNOS — CID 3393731
N-(3-chloro-4-fluorophenyl)-2-prop-2-enylsulfanylacetamide (PubChem CID 3393731) has the molecular formula C11H11ClFNOS and a molecular weight of 259.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-prop-2-enylsulfanylacetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-prop-2-enylsulfanylacetamide |
|---|---|
| PubChem CID | 3393731 |
| Molecular Formula | C11H11ClFNOS |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-prop-2-enylsulfanylacetamide |
| SMILES | C=CCSCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClFNOS/c1-2-5-16-7-11(15)14-8-3-4-10(13)9(12)6-8/h2-4,6H,1,5,7H2,(H,14,15) |
| InChIKey | LCMFGGHPSMJVIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|