C10H9ClFNO3S — CID 710279
2-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 710279) has the molecular formula C10H9ClFNO3S and a molecular weight of 277.70 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 710279 |
| Molecular Formula | C10H9ClFNO3S |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 2-[2-(3-chloro-4-fluoroanilino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClFNO3S/c11-7-3-6(1-2-8(7)12)13-9(14)4-17-5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16) |
| InChIKey | MWAQQQBWXJNSMX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |