C10H10ClFN2OS2 — CID 82182310
2-(2-amino-2-sulfanylideneethyl)sulfanyl-N-(3-chloro-4-fluorophenyl)acetamide (PubChem CID 82182310) has the molecular formula C10H10ClFN2OS2 and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-(2-amino-2-sulfanylideneethyl)sulfanyl-N-(3-chloro-4-fluorophenyl)acetamide.
| Compound Name | 2-(2-amino-2-sulfanylideneethyl)sulfanyl-N-(3-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 82182310 |
| Molecular Formula | C10H10ClFN2OS2 |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 2-(2-amino-2-sulfanylideneethyl)sulfanyl-N-(3-chloro-4-fluorophenyl)acetamide |
| SMILES | NC(=S)CSCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClFN2OS2/c11-7-3-6(1-2-8(7)12)14-10(15)5-17-4-9(13)16/h1-3H,4-5H2,(H2,13,16)(H,14,15) |
| InChIKey | XBOMFBRHFLUSHK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|