C11H12ClN3O3S — CID 2075802
2-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-N-(4-chlorophenyl)acetamide (PubChem CID 2075802) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.76 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 2075802 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-N-(4-chlorophenyl)acetamide |
| SMILES | NC(=O)NC(=O)CSCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3O3S/c12-7-1-3-8(4-2-7)14-9(16)5-19-6-10(17)15-11(13)18/h1-4H,5-6H2,(H,14,16)(H3,13,15,17,18) |
| InChIKey | DFMQTEQFXXIOFN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |