C15H20ClN3O3S — CID 9163333
2-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]-N-propylacetamide (PubChem CID 9163333) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is 2-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]-N-propylacetamide.
| Compound Name | 2-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 9163333 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[[2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNC(=O)CSCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN3O3S/c1-2-7-17-13(20)8-18-14(21)9-23-10-15(22)19-12-5-3-11(16)4-6-12/h3-6H,2,7-10H2,1H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | BAYQXFIXCSMPQE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |