C17H22ClN3O5S — CID 8576458
[2-(butylcarbamoylamino)-2-oxoethyl] 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 8576458) has the molecular formula C17H22ClN3O5S and a molecular weight of 415.90 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 8576458 |
| Molecular Formula | C17H22ClN3O5S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 2-[2-(4-chloroanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)CSCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClN3O5S/c1-2-3-8-19-17(25)21-14(22)9-26-16(24)11-27-10-15(23)20-13-6-4-12(18)5-7-13/h4-7H,2-3,8-11H2,1H3,(H,20,23)(H2,19,21,22,25) |
| InChIKey | YLYARVRCLLJEBU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|