C14H16FN3O5S — CID 7812295
[2-(methylcarbamoylamino)-2-oxoethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 7812295) has the molecular formula C14H16FN3O5S and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7812295 |
| Molecular Formula | C14H16FN3O5S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | CNC(=O)NC(=O)COC(=O)CSCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN3O5S/c1-16-14(22)18-11(19)6-23-13(21)8-24-7-12(20)17-10-4-2-9(15)3-5-10/h2-5H,6-8H2,1H3,(H,17,20)(H2,16,18,19,22) |
| InChIKey | DHZSONWLJALATC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |