C12H13FN2O5 — CID 7791448
[2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 7791448) has the molecular formula C12H13FN2O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7791448 |
| Molecular Formula | C12H13FN2O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | CNC(=O)NC(=O)COC(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O5/c1-14-12(18)15-10(16)6-20-11(17)7-19-9-4-2-8(13)3-5-9/h2-5H,6-7H2,1H3,(H2,14,15,16,18) |
| InChIKey | JKEMGAZUPCXFER-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |