C9H11ClN3OS+ — CID 2113962
[amino-[2-(4-chloroanilino)-2-oxoethyl]sulfanylmethylidene]azanium (PubChem CID 2113962) has the molecular formula C9H11ClN3OS+ and a molecular weight of 244.73 g/mol. Its IUPAC name is [amino-[2-(4-chloroanilino)-2-oxoethyl]sulfanylmethylidene]azanium.
| Compound Name | [amino-[2-(4-chloroanilino)-2-oxoethyl]sulfanylmethylidene]azanium |
|---|---|
| PubChem CID | 2113962 |
| Molecular Formula | C9H11ClN3OS+ |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [amino-[2-(4-chloroanilino)-2-oxoethyl]sulfanylmethylidene]azanium |
| SMILES | NC(=[NH2+])SCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10ClN3OS/c10-6-1-3-7(4-2-6)13-8(14)5-15-9(11)12/h1-4H,5H2,(H3,11,12)(H,13,14)/p+1 |
| InChIKey | PIFOLZDLVFXFHY-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|