C18H14ClN3O3 — CID 5302279
2-[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]-2-oxoacetamide (PubChem CID 5302279) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is 2-[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]-2-oxoacetamide.
| Compound Name | 2-[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 5302279 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[1-[2-(4-chloroanilino)-2-oxoethyl]indol-3-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1cn(CC(=O)Nc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C18H14ClN3O3/c19-11-5-7-12(8-6-11)21-16(23)10-22-9-14(17(24)18(20)25)13-3-1-2-4-15(13)22/h1-9H,10H2,(H2,20,25)(H,21,23) |
| InChIKey | OTMUDLKZJXNVSE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|