C17H12ClFN2O2 — CID 775578
N-(3-chloro-4-fluorophenyl)-2-(3-formylindol-1-yl)acetamide (PubChem CID 775578) has the molecular formula C17H12ClFN2O2 and a molecular weight of 330.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(3-formylindol-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(3-formylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 775578 |
| Molecular Formula | C17H12ClFN2O2 |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(3-formylindol-1-yl)acetamide |
| SMILES | O=Cc1cn(CC(=O)Nc2ccc(F)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C17H12ClFN2O2/c18-14-7-12(5-6-15(14)19)20-17(23)9-21-8-11(10-22)13-3-1-2-4-16(13)21/h1-8,10H,9H2,(H,20,23) |
| InChIKey | HVTFVMWZGMNBTP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|