C18H15FN2O2 — CID 5077099
N-(3-fluoro-2-methylphenyl)-2-(3-formylindol-1-yl)acetamide (PubChem CID 5077099) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)-2-(3-formylindol-1-yl)acetamide.
| Compound Name | N-(3-fluoro-2-methylphenyl)-2-(3-formylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 5077099 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)-2-(3-formylindol-1-yl)acetamide |
| SMILES | Cc1c(F)cccc1NC(=O)Cn1cc(C=O)c2ccccc21 |
| InChI | InChI=1S/C18H15FN2O2/c1-12-15(19)6-4-7-16(12)20-18(23)10-21-9-13(11-22)14-5-2-3-8-17(14)21/h2-9,11H,10H2,1H3,(H,20,23) |
| InChIKey | AWKRKCQJMIJTOL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|