C18H15BrN2O2 — CID 46858697
N-(2-bromo-4-methylphenyl)-2-(3-formylindol-1-yl)acetamide (PubChem CID 46858697) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(3-formylindol-1-yl)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(3-formylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 46858697 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(3-formylindol-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cc(C=O)c3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C18H15BrN2O2/c1-12-6-7-16(15(19)8-12)20-18(23)10-21-9-13(11-22)14-4-2-3-5-17(14)21/h2-9,11H,10H2,1H3,(H,20,23) |
| InChIKey | UFJNFPYXCHYAAL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|