About N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide
N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide (PubChem CID 5071903) has the molecular formula C21H21BrN2O2
and a molecular weight of 413.32 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide |
| PubChem CID | 5071903 |
| Molecular Formula | C21H21BrN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide |
| SMILES | CCc1cccc2c(C=O)cn(CC(=O)Nc3cc(C)c(C)cc3Br)c12 |
| InChI | InChI=1S/C21H21BrN2O2/c1-4-15-6-5-7-17-16(12-25)10-24(21(15)17)11-20(26)23-19-9-14(3)13(2)8-18(19)22/h5-10,12H,4,11H2,1-3H3,(H,23,26) |
| InChIKey | VBVSVQVLCRXTTB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide?
The IUPAC name of N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide (CID 5071903) is N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide.
What is the SMILES notation for N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide?
The canonical SMILES for N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide is CCc1cccc2c(C=O)cn(CC(=O)Nc3cc(C)c(C)cc3Br)c12.
What is the InChIKey of N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide?
The InChIKey is VBVSVQVLCRXTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21BrN2O2/c1-4-15-6-5-7-17-16(12-25)10-24(21(15)17)11-20(26)23-19-9-14(3)13(2)8-18(19)22/h5-10,12H,4,11H2,1-3H3,(H,23,26).
What are the key properties of N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide?
N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide has a molecular weight of 413.32 g/mol, XLogP of 5.03, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-4,5-dimethylphenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide is sourced from PubChem (CID 5071903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).