C20H17N3O2 — CID 4294067
N-(4-cyanophenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide (PubChem CID 4294067) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide.
| Compound Name | N-(4-cyanophenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 4294067 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-(4-cyanophenyl)-2-(7-ethyl-3-formylindol-1-yl)acetamide |
| SMILES | CCc1cccc2c(C=O)cn(CC(=O)Nc3ccc(C#N)cc3)c12 |
| InChI | InChI=1S/C20H17N3O2/c1-2-15-4-3-5-18-16(13-24)11-23(20(15)18)12-19(25)22-17-8-6-14(10-21)7-9-17/h3-9,11,13H,2,12H2,1H3,(H,22,25) |
| InChIKey | GLJJXSLIQPHVCG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|