C20H18BrNOS — CID 126178248
N-(2-bromo-4,5-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide (PubChem CID 126178248) has the molecular formula C20H18BrNOS and a molecular weight of 400.34 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 126178248 |
| Molecular Formula | C20H18BrNOS |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide |
| SMILES | Cc1cc(Br)c(NC(=O)CSc2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C20H18BrNOS/c1-13-10-17(21)18(11-14(13)2)22-20(23)12-24-19-9-5-7-15-6-3-4-8-16(15)19/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | FXXDXJMXSQXJNF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |