C20H18INOS — CID 126189699
N-(4-iodo-2,6-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide (PubChem CID 126189699) has the molecular formula C20H18INOS and a molecular weight of 447.34 g/mol. Its IUPAC name is N-(4-iodo-2,6-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide.
| Compound Name | N-(4-iodo-2,6-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 126189699 |
| Molecular Formula | C20H18INOS |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-(4-iodo-2,6-dimethylphenyl)-2-naphthalen-1-ylsulfanylacetamide |
| SMILES | Cc1cc(I)cc(C)c1NC(=O)CSc1cccc2ccccc12 |
| InChI | InChI=1S/C20H18INOS/c1-13-10-16(21)11-14(2)20(13)22-19(23)12-24-18-9-5-7-15-6-3-4-8-17(15)18/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | RZMVMUIEQJSMLZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|