C19H22BrNOS — CID 4092566
N-(2-bromophenyl)-2-(5-tert-butyl-2-methylphenyl)sulfanylacetamide (PubChem CID 4092566) has the molecular formula C19H22BrNOS and a molecular weight of 392.36 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(5-tert-butyl-2-methylphenyl)sulfanylacetamide.
| Compound Name | N-(2-bromophenyl)-2-(5-tert-butyl-2-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 4092566 |
| Molecular Formula | C19H22BrNOS |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-(2-bromophenyl)-2-(5-tert-butyl-2-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1SCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C19H22BrNOS/c1-13-9-10-14(19(2,3)4)11-17(13)23-12-18(22)21-16-8-6-5-7-15(16)20/h5-11H,12H2,1-4H3,(H,21,22) |
| InChIKey | PGSIVZJGAKYVIC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |