C20H21F4NOS — CID 4299760
2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 4299760) has the molecular formula C20H21F4NOS and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4299760 |
| Molecular Formula | C20H21F4NOS |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1SCC(=O)Nc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H21F4NOS/c1-12-5-6-13(19(2,3)4)9-17(12)27-11-18(26)25-16-8-7-14(21)10-15(16)20(22,23)24/h5-10H,11H2,1-4H3,(H,25,26) |
| InChIKey | OTAHHMVWICXBKV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |