C9H6ClF4NO — CID 83315794
2-chloro-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 83315794) has the molecular formula C9H6ClF4NO and a molecular weight of 255.60 g/mol. Its IUPAC name is 2-chloro-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 83315794 |
| Molecular Formula | C9H6ClF4NO |
| Molecular Weight | 255.60 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 2-chloro-N-[4-fluoro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H6ClF4NO/c10-4-8(16)15-7-2-1-5(11)3-6(7)9(12,13)14/h1-3H,4H2,(H,15,16) |
| InChIKey | YULNFJFIZUZCBM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|