C16H13ClF4N2O — CID 109042072
N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-fluoroanilino)propanamide (PubChem CID 109042072) has the molecular formula C16H13ClF4N2O and a molecular weight of 360.74 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-fluoroanilino)propanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 109042072 |
| Molecular Formula | C16H13ClF4N2O |
| Molecular Weight | 360.74 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-fluoroanilino)propanamide |
| SMILES | O=C(CCNc1cccc(F)c1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13ClF4N2O/c17-10-4-5-14(13(8-10)16(19,20)21)23-15(24)6-7-22-12-3-1-2-11(18)9-12/h1-5,8-9,22H,6-7H2,(H,23,24) |
| InChIKey | CKAGESPAMOSOBD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |