C20H22ClF2NO2S — CID 4218644
2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-[chloro(difluoro)methoxy]phenyl]acetamide (PubChem CID 4218644) has the molecular formula C20H22ClF2NO2S and a molecular weight of 413.92 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-[chloro(difluoro)methoxy]phenyl]acetamide.
| Compound Name | 2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-[chloro(difluoro)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 4218644 |
| Molecular Formula | C20H22ClF2NO2S |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[4-[chloro(difluoro)methoxy]phenyl]acetamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1SCC(=O)Nc1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C20H22ClF2NO2S/c1-13-5-6-14(19(2,3)4)11-17(13)27-12-18(25)24-15-7-9-16(10-8-15)26-20(21,22)23/h5-11H,12H2,1-4H3,(H,24,25) |
| InChIKey | BMCOTPSBBZGFPO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|