C17H16F3N3O3S — CID 46633568
2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 46633568) has the molecular formula C17H16F3N3O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is 2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 46633568 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | NC(=O)CSc1ccccc1NCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3N3O3S/c18-17(19,20)26-12-7-5-11(6-8-12)23-16(25)9-22-13-3-1-2-4-14(13)27-10-15(21)24/h1-8,22H,9-10H2,(H2,21,24)(H,23,25) |
| InChIKey | JFSMBBLNIKKUCE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |