C17H15F3N2O4 — CID 30644453
methyl 4-[[2-[2-(trifluoromethoxy)anilino]acetyl]amino]benzoate (PubChem CID 30644453) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is methyl 4-[[2-[2-(trifluoromethoxy)anilino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(trifluoromethoxy)anilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30644453 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | methyl 4-[[2-[2-(trifluoromethoxy)anilino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CNc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N2O4/c1-25-16(24)11-6-8-12(9-7-11)22-15(23)10-21-13-4-2-3-5-14(13)26-17(18,19)20/h2-9,21H,10H2,1H3,(H,22,23) |
| InChIKey | TVUGDEBKZMDBPD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |