methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate

C21H24N2O4 — CID 60536886

IUPACmethyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)CNc2ccccc2OC2CCCC2)cc1
InChIInChI=1S/C21H24N2O4/c1-26-21(25)15-10-12-16(13-11-15)23-20(24)14-22-18-8-4-5-9-19(18)27-17-6-2-3-7-17/h4-5,8-13,17,22H,2-3,6-7,14H2,1H3,(H,23,24)
InChIKeyHHJVGEKGTAKJJB-UHFFFAOYSA-N
MW368.43 g/mol
LogP3.85
Rot. Bonds7

About methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate

methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate (PubChem CID 60536886) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate
PubChem CID60536886
Molecular FormulaC21H24N2O4
Molecular Weight368.43 g/mol
Exact Mass368.17
IUPAC Namemethyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)CNc2ccccc2OC2CCCC2)cc1
InChIInChI=1S/C21H24N2O4/c1-26-21(25)15-10-12-16(13-11-15)23-20(24)14-22-18-8-4-5-9-19(18)27-17-6-2-3-7-17/h4-5,8-13,17,22H,2-3,6-7,14H2,1H3,(H,23,24)
InChIKeyHHJVGEKGTAKJJB-UHFFFAOYSA-N
XLogP3.85
TPSA76.66 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.43
LogP ≤ 53.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate?
The IUPAC name of methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate (CID 60536886) is methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate.
What is the SMILES notation for methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate?
The canonical SMILES for methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate is COC(=O)c1ccc(NC(=O)CNc2ccccc2OC2CCCC2)cc1.
What is the InChIKey of methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate?
The InChIKey is HHJVGEKGTAKJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4/c1-26-21(25)15-10-12-16(13-11-15)23-20(24)14-22-18-8-4-5-9-19(18)27-17-6-2-3-7-17/h4-5,8-13,17,22H,2-3,6-7,14H2,1H3,(H,23,24).
What are the key properties of methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate?
methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate has a molecular weight of 368.43 g/mol, XLogP of 3.85, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(2-cyclopentyloxyanilino)acetyl]amino]benzoate is sourced from PubChem (CID 60536886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).