C21H27N3O3 — CID 60536782
methyl 4-[[2-[2-(diethylaminomethyl)anilino]acetyl]amino]benzoate (PubChem CID 60536782) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is methyl 4-[[2-[2-(diethylaminomethyl)anilino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(diethylaminomethyl)anilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 60536782 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | methyl 4-[[2-[2-(diethylaminomethyl)anilino]acetyl]amino]benzoate |
| SMILES | CCN(CC)Cc1ccccc1NCC(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-4-24(5-2)15-17-8-6-7-9-19(17)22-14-20(25)23-18-12-10-16(11-13-18)21(26)27-3/h6-13,22H,4-5,14-15H2,1-3H3,(H,23,25) |
| InChIKey | IKIWDHMSRISZPE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |