C17H17N3O4 — CID 30637236
methyl 4-[[2-(2-carbamoylanilino)acetyl]amino]benzoate (PubChem CID 30637236) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is methyl 4-[[2-(2-carbamoylanilino)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2-carbamoylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30637236 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | methyl 4-[[2-(2-carbamoylanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CNc2ccccc2C(N)=O)cc1 |
| InChI | InChI=1S/C17H17N3O4/c1-24-17(23)11-6-8-12(9-7-11)20-15(21)10-19-14-5-3-2-4-13(14)16(18)22/h2-9,19H,10H2,1H3,(H2,18,22)(H,20,21) |
| InChIKey | ZDRLZTOCTZNQLF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |