C19H23N3O2S — CID 46700581
2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-(3-propan-2-ylphenyl)acetamide (PubChem CID 46700581) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-(3-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-(3-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46700581 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[2-(2-amino-2-oxoethyl)sulfanylanilino]-N-(3-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1cccc(NC(=O)CNc2ccccc2SCC(N)=O)c1 |
| InChI | InChI=1S/C19H23N3O2S/c1-13(2)14-6-5-7-15(10-14)22-19(24)11-21-16-8-3-4-9-17(16)25-12-18(20)23/h3-10,13,21H,11-12H2,1-2H3,(H2,20,23)(H,22,24) |
| InChIKey | PGXQGCOUURXPOX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |