C15H15BrN2OS — CID 79143132
2-(2-amino-5-methylphenyl)sulfanyl-N-(2-bromophenyl)acetamide (PubChem CID 79143132) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is 2-(2-amino-5-methylphenyl)sulfanyl-N-(2-bromophenyl)acetamide.
| Compound Name | 2-(2-amino-5-methylphenyl)sulfanyl-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 79143132 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2-(2-amino-5-methylphenyl)sulfanyl-N-(2-bromophenyl)acetamide |
| SMILES | Cc1ccc(N)c(SCC(=O)Nc2ccccc2Br)c1 |
| InChI | InChI=1S/C15H15BrN2OS/c1-10-6-7-12(17)14(8-10)20-9-15(19)18-13-5-3-2-4-11(13)16/h2-8H,9,17H2,1H3,(H,18,19) |
| InChIKey | LDUFZRVZIFHFER-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|