C12H12BrN5OS — CID 1143775
N-(2-bromophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide (PubChem CID 1143775) has the molecular formula C12H12BrN5OS and a molecular weight of 354.23 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-bromophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1143775 |
| Molecular Formula | C12H12BrN5OS |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-(2-bromophenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2ccccc2Br)n1 |
| InChI | InChI=1S/C12H12BrN5OS/c13-7-3-1-2-4-8(7)16-11(19)6-20-12-17-9(14)5-10(15)18-12/h1-5H,6H2,(H,16,19)(H4,14,15,17,18) |
| InChIKey | FAOAHHMNRPBJMO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |